Products 1515918-28-1
CAS 1515918-28-1 is the registry number for 2-Amino-2-(4-bromophenyl)-4-methylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-amino-2-(4-bromophenyl)-4-methylpentanoic acid (CAS 1515918-28-1) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 2-amino-2-(4-bromophenyl)-4-methylpentanoic acid. InChIKey: XSEHJTKHRJFECV-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 2-amino-2-(4-bromophenyl)-4-methylpentanoic acid |
| InChIKey | XSEHJTKHRJFECV-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C1=CC=C(C=C1)Br)(C(=O)O)N |
Computed by PubChem (NCBI)