Products 1515924-80-7
CAS 1515924-80-7 is the registry number for 3-(5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl)oxetan-3-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxetan-3-ol (CAS 1515924-80-7) is a chemical compound with the molecular formula C13H19BN2O4 and a molecular weight of 278.11 g/mol. IUPAC name: 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxetan-3-ol. InChIKey: TYIQGLGKJWHRFR-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O4 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]oxetan-3-ol |
| InChIKey | TYIQGLGKJWHRFR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C3(COC3)O |
Computed by PubChem (NCBI)