CAS 2223043-99-8 is the registry number for 2-(Ethoxycarbonyl)pyrimidine-5-boronic acid pinacol ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate (CAS 2223043-99-8) is a chemical compound with the molecular formula C13H19BN2O4 and a molecular weight of 278.11 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate. InChIKey: VZLFZIQQRQKCGX-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O4 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
| InChIKey | VZLFZIQQRQKCGX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(=O)OCC |
Computed by PubChem (NCBI)