CAS 2454515-20-7 is the registry number for 4-Methyl-2-nitro-6-(tetramethyl-1,3,2-dioxaborolan-2-yl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-methyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2454515-20-7) is a chemical compound with the molecular formula C13H19BN2O4 and a molecular weight of 278.11 g/mol. IUPAC name: 4-methyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: ANOLJAUGIKJKOL-UHFFFAOYSA-N.
| Molecular formula | C13H19BN2O4 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 4-methyl-2-nitro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | ANOLJAUGIKJKOL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2N)[N+](=O)[O-])C |
Computed by PubChem (NCBI)