Products 1516310-10-3
CAS 1516310-10-3 is the registry number for Methyl 2-amino-6-fluoro-4-methoxybenzoate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 50mg, 100mg.
Methyl 2-amino-6-fluoro-4-methoxybenzoate (CAS 1516310-10-3) is a chemical compound with the molecular formula C9H10FNO3 and a molecular weight of 199.18 g/mol. IUPAC name: methyl 2-amino-6-fluoro-4-methoxybenzoate. InChIKey: GFQXXFLYZCJMKY-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3 |
|---|---|
| Molecular weight | 199.18 g/mol |
| IUPAC name | methyl 2-amino-6-fluoro-4-methoxybenzoate |
| InChIKey | GFQXXFLYZCJMKY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)F)C(=O)OC)N |
Computed by PubChem (NCBI)