CAS 1516580-07-6 is the registry number for 1–Bromo–4–fluoro–2–(4–nitrophenoxy)benzene. Offered by: GLPBio. Available pack sizes: 100mg.
1-bromo-4-fluoro-2-(4-nitrophenoxy)benzene (CAS 1516580-07-6) is a chemical compound with the molecular formula C12H7BrFNO3 and a molecular weight of 312.09 g/mol. IUPAC name: 1-bromo-4-fluoro-2-(4-nitrophenoxy)benzene. InChIKey: CIGSTSNAMRIEBS-UHFFFAOYSA-N.
| Molecular formula | C12H7BrFNO3 |
|---|---|
| Molecular weight | 312.09 g/mol |
| IUPAC name | 1-bromo-4-fluoro-2-(4-nitrophenoxy)benzene |
| InChIKey | CIGSTSNAMRIEBS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OC2=C(C=CC(=C2)F)Br |
Computed by PubChem (NCBI)