Products 2969482-81-1
CAS 2969482-81-1 is the registry number for 2-bromo-1-fluoro-3-(4-nitrophenoxy)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 5g.
2-bromo-1-fluoro-3-(4-nitrophenoxy)benzene (CAS 2969482-81-1) is a chemical compound with the molecular formula C12H7BrFNO3 and a molecular weight of 312.09 g/mol. IUPAC name: 2-bromo-1-fluoro-3-(4-nitrophenoxy)benzene. InChIKey: PJMUCUBITOWALO-UHFFFAOYSA-N.
| Molecular formula | C12H7BrFNO3 |
|---|---|
| Molecular weight | 312.09 g/mol |
| IUPAC name | 2-bromo-1-fluoro-3-(4-nitrophenoxy)benzene |
| InChIKey | PJMUCUBITOWALO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)