Products 953901-37-6
CAS 953901-37-6 appears in our catalog under these names: 6-(2-Bromo-4-fluorophenoxy)pyridine-3-carboxylic acid, 95%, 6-(2-Bromo-4-fluorophenoxy)pyridine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
6-(2-bromo-4-fluorophenoxy)pyridine-3-carboxylic acid (CAS 953901-37-6) is a chemical compound with the molecular formula C12H7BrFNO3 and a molecular weight of 312.09 g/mol. IUPAC name: 6-(2-bromo-4-fluorophenoxy)pyridine-3-carboxylic acid. InChIKey: PGPHGIWPCDRYEY-UHFFFAOYSA-N.
| Molecular formula | C12H7BrFNO3 |
|---|---|
| Molecular weight | 312.09 g/mol |
| IUPAC name | 6-(2-bromo-4-fluorophenoxy)pyridine-3-carboxylic acid |
| InChIKey | PGPHGIWPCDRYEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC2=NC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)