Products 151673-92-6

CAS 151673-92-6 appears in our catalog under these names: Penehyclidine Impurity 11, Penehyclidine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-cyclopentyl-2-phenylacetaldehyde (CAS 151673-92-6) is a chemical compound with the molecular formula C13H16O and a molecular weight of 188.26 g/mol. IUPAC name: 2-cyclopentyl-2-phenylacetaldehyde. InChIKey: MVTLVNSMHICGCS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O
Molecular weight188.26 g/mol
IUPAC name2-cyclopentyl-2-phenylacetaldehyde
InChIKeyMVTLVNSMHICGCS-UHFFFAOYSA-N
SMILESC1CCC(C1)C(C=O)C2=CC=CC=C2

Computed by PubChem (NCBI)