CAS 1517-82-4 appears in our catalog under these names: (1S)-2-Isopropyl-5-methylcyclohexyl 4-methylbenzenesulfinate, 95%, (1R,2S,5R)-(-)-Menthyl (S)-p-Toluenesulfinate, (1R,2S,5R)–(–)–Menthyl (S)–p–Toluenesulfinate, (1R,2S,5R)-(-)-Menthyl (S)-p-Toluenesulfinate, >98.0%(HPLC), (1R,2S,5R)-(-)-Menthyl (S)-p-toluenesulfinate, 98%. Offered by: Fluorochem, TRC, GLPBio, TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 25g, 100g, 2,5g, 10g, 500g.
[(1S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate (CAS 1517-82-4) is a chemical compound with the molecular formula C17H26O2S and a molecular weight of 294.5 g/mol. IUPAC name: [(1S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate. InChIKey: NQICGNSARVCSGJ-UPSPKRPTSA-N.
| Molecular formula | C17H26O2S |
|---|---|
| Molecular weight | 294.5 g/mol |
| IUPAC name | [(1S)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate |
| InChIKey | NQICGNSARVCSGJ-UPSPKRPTSA-N |
| SMILES | CC1CCC([C@H](C1)OS(=O)C2=CC=C(C=C2)C)C(C)C |
Computed by PubChem (NCBI)