CAS 20752-45-8 appears in our catalog under these names: (1S,2R,5S)-(+)-Menthyl (r)-p-toluenesulfinate, 95%, (1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl 4-methylbenzenesulfinate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate (CAS 20752-45-8) is a chemical compound with the molecular formula C17H26O2S and a molecular weight of 294.5 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate. InChIKey: NQICGNSARVCSGJ-IUINDACWSA-N.
| Molecular formula | C17H26O2S |
|---|---|
| Molecular weight | 294.5 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate |
| InChIKey | NQICGNSARVCSGJ-IUINDACWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OS(=O)C2=CC=C(C=C2)C)C(C)C |
Computed by PubChem (NCBI)