CAS 91796-57-5 appears in our catalog under these names: (1S,2R,5S)–(+)–Menthyl (R)–p–Toluenesulfinate, (1S,2R,5S)-(+)-Menthyl (R)-p-Toluenesulfinate, (1S,2R,5S)-(+)-Menthyl (R)-p-Toluenesulfinate, >97.0%(HPLC), (R)-(5S)-2-Isopropyl-5-methylcyclohexyl 4-methylbenzenesulfinate, 97%, 97%, (-)-MENTHYL P-TOLUENESULFINATE, 97%. Offered by: GLPBio, Biosynth, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate (CAS 91796-57-5) is a chemical compound with the molecular formula C17H26O2S and a molecular weight of 294.5 g/mol. IUPAC name: [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate. InChIKey: NQICGNSARVCSGJ-IUINDACWSA-N.
| Molecular formula | C17H26O2S |
|---|---|
| Molecular weight | 294.5 g/mol |
| IUPAC name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 4-methylbenzenesulfinate |
| InChIKey | NQICGNSARVCSGJ-IUINDACWSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@H](C1)OS(=O)C2=CC=C(C=C2)C)C(C)C |
Computed by PubChem (NCBI)