Products 1517038-16-2
CAS 1517038-16-2 is the registry number for 3-bromo-1-(propan-2-yl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-bromo-1-propan-2-ylpyrazole-4-carboxylic acid (CAS 1517038-16-2) is a chemical compound with the molecular formula C7H9BrN2O2 and a molecular weight of 233.06 g/mol. IUPAC name: 3-bromo-1-propan-2-ylpyrazole-4-carboxylic acid. InChIKey: FHQZDWWXIGFQSR-UHFFFAOYSA-N.
| Molecular formula | C7H9BrN2O2 |
|---|---|
| Molecular weight | 233.06 g/mol |
| IUPAC name | 3-bromo-1-propan-2-ylpyrazole-4-carboxylic acid |
| InChIKey | FHQZDWWXIGFQSR-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=N1)Br)C(=O)O |
Computed by PubChem (NCBI)