CAS 151720-90-0 is the registry number for Dehydroxyamino Oxamflatin Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoic acid (CAS 151720-90-0) is a chemical compound with the molecular formula C17H13NO4S and a molecular weight of 327.4 g/mol. IUPAC name: (E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoic acid. InChIKey: MJBHEINNBFZEII-LFYBBSHMSA-N.
| Molecular formula | C17H13NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | (E)-5-[3-(benzenesulfonamido)phenyl]pent-2-en-4-ynoic acid |
| InChIKey | MJBHEINNBFZEII-LFYBBSHMSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC(=C2)C#C/C=C/C(=O)O |
Computed by PubChem (NCBI)