Products 186032-64-4
CAS 186032-64-4 is the registry number for 3-(Naphthalene-2-sulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(naphthalen-2-ylsulfonylamino)benzoic acid (CAS 186032-64-4) is a chemical compound with the molecular formula C17H13NO4S and a molecular weight of 327.4 g/mol. IUPAC name: 3-(naphthalen-2-ylsulfonylamino)benzoic acid. InChIKey: KKLUFCAOPPZISL-UHFFFAOYSA-N.
| Molecular formula | C17H13NO4S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 3-(naphthalen-2-ylsulfonylamino)benzoic acid |
| InChIKey | KKLUFCAOPPZISL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(naphthalene-2-sulfonamido)benzoic acid, 3-(naphthalen-2-ylsulfonylamino)benzoic Acid, Oprea1_021634, Oprea1_482489, KKLUFCAOPPZISL-UHFFFAOYSA-N, 3-(2-naphthylsulfonamido)benzoic acid, 3-(naphthalene-2-sulfonamido)benzoicacid, 3-[(2-naphthylsulfonyl)amino]benzoic acid, 3-((2-Naphthalenyl)sulfonyl)aminobenzoic acid