Products 315679-74-4

CAS 315679-74-4 is the registry number for Methyl 2-(furan-2-carboxamido)-4-phenylthiophene-3-carboxylate. Offered by: Chemat. Available pack sizes: 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-(furan-2-carbonylamino)-4-phenylthiophene-3-carboxylate (CAS 315679-74-4) is a chemical compound with the molecular formula C17H13NO4S and a molecular weight of 327.4 g/mol. IUPAC name: methyl 2-(furan-2-carbonylamino)-4-phenylthiophene-3-carboxylate. InChIKey: STIDEPANONMLDZ-UHFFFAOYSA-N.

Identity
Molecular formulaC17H13NO4S
Molecular weight327.4 g/mol
IUPAC namemethyl 2-(furan-2-carbonylamino)-4-phenylthiophene-3-carboxylate
InChIKeySTIDEPANONMLDZ-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(SC=C1C2=CC=CC=C2)NC(=O)C3=CC=CO3

Computed by PubChem (NCBI)