Products 1517201-15-8

CAS 1517201-15-8 appears in our catalog under these names: 2,4-Dimethylpentane-1-sulfonyl chloride, 95%, 2,4-Dimethylpentane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2,4-dimethylpentane-1-sulfonyl chloride (CAS 1517201-15-8) is a chemical compound with the molecular formula C7H15ClO2S and a molecular weight of 198.71 g/mol. IUPAC name: 2,4-dimethylpentane-1-sulfonyl chloride. InChIKey: BIZSAASKRJUBBN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClO2S
Molecular weight198.71 g/mol
IUPAC name2,4-dimethylpentane-1-sulfonyl chloride
InChIKeyBIZSAASKRJUBBN-UHFFFAOYSA-N
SMILESCC(C)CC(C)CS(=O)(=O)Cl

Computed by PubChem (NCBI)