Products 1999777-81-9

CAS 1999777-81-9 appears in our catalog under these names: 3,3-Dimethylpentane-1-sulfonyl chloride, 95%, 3,3-Dimethylpentane-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

3,3-dimethylpentane-1-sulfonyl chloride (CAS 1999777-81-9) is a chemical compound with the molecular formula C7H15ClO2S and a molecular weight of 198.71 g/mol. IUPAC name: 3,3-dimethylpentane-1-sulfonyl chloride. InChIKey: IVLOMAGATQDKQC-UHFFFAOYSA-N.

Identity
Molecular formulaC7H15ClO2S
Molecular weight198.71 g/mol
IUPAC name3,3-dimethylpentane-1-sulfonyl chloride
InChIKeyIVLOMAGATQDKQC-UHFFFAOYSA-N
SMILESCCC(C)(C)CCS(=O)(=O)Cl

Computed by PubChem (NCBI)