CAS 15174-02-4 appears in our catalog under these names: 4–Methoxy–3–nitrophenol, 4-Methoxy-3-nitrophenol 97%, 4-Methoxy-3-nitrophenol, 98%, 4-Methoxy-3-nitrophenol, >95% (HPLC), 4-Methoxy-3-nitrophenol, 98%, 98%. Offered by: GLPBio, Ambeed, Fluorochem, TRC, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g, 25g, 100g, 100mg, 500mg.
4-methoxy-3-nitrophenol (CAS 15174-02-4) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 4-methoxy-3-nitrophenol. InChIKey: AADXAMFLYDYIFS-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 4-methoxy-3-nitrophenol |
| InChIKey | AADXAMFLYDYIFS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)