Products 1517549-87-9
CAS 1517549-87-9 is the registry number for 5-(1,5-Dimethyl-1H-pyrazol-4-yl)imidazolidine-2,4-dione. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(1,5-dimethylpyrazol-4-yl)imidazolidine-2,4-dione (CAS 1517549-87-9) is a chemical compound with the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. IUPAC name: 5-(1,5-dimethylpyrazol-4-yl)imidazolidine-2,4-dione. InChIKey: MAMKDDJKXZRTPY-UHFFFAOYSA-N.
| Molecular formula | C8H10N4O2 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 5-(1,5-dimethylpyrazol-4-yl)imidazolidine-2,4-dione |
| InChIKey | MAMKDDJKXZRTPY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1C)C2C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)