CAS 1518-56-5 appears in our catalog under these names: Glucose Impurity 2, a-isosaccharinic acid epimer. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoic acid (CAS 1518-56-5) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 180.16 g/mol. IUPAC name: (2R,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoic acid. InChIKey: SGOVJIDEXZEOTB-UJURSFKZSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | (2R,4S)-2,4,5-trihydroxy-2-(hydroxymethyl)pentanoic acid |
| InChIKey | SGOVJIDEXZEOTB-UJURSFKZSA-N |
| SMILES | C([C@@H](CO)O)[C@@](CO)(C(=O)O)O |
Computed by PubChem (NCBI)