Products 1518-97-4
CAS 1518-97-4 is the registry number for (1R, 2S)-Isoxsuprine. Offered by: TRC. Available pack sizes: 1mg, 25mg.
4-[(1R,2S)-1-hydroxy-2-[[(2R)-1-phenoxypropan-2-yl]amino]propyl]phenol (CAS 1518-97-4) is a chemical compound with the molecular formula C18H23NO3 and a molecular weight of 301.4 g/mol. IUPAC name: 4-[(1R,2S)-1-hydroxy-2-[[(2R)-1-phenoxypropan-2-yl]amino]propyl]phenol. InChIKey: BMUKKTUHUDJSNZ-GLJUWKHASA-N.
| Molecular formula | C18H23NO3 |
|---|---|
| Molecular weight | 301.4 g/mol |
| IUPAC name | 4-[(1R,2S)-1-hydroxy-2-[[(2R)-1-phenoxypropan-2-yl]amino]propyl]phenol |
| InChIKey | BMUKKTUHUDJSNZ-GLJUWKHASA-N |
| SMILES | C[C@H](COC1=CC=CC=C1)N[C@@H](C)[C@@H](C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)