CAS 1518904-21-6 is the registry number for 7,8-Dimethylchromane-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7,8-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid (CAS 1518904-21-6) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 7,8-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid. InChIKey: FNOIAGMQRADWHU-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 7,8-dimethyl-3,4-dihydro-2H-chromene-3-carboxylic acid |
| InChIKey | FNOIAGMQRADWHU-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(CC(CO2)C(=O)O)C=C1)C |
Computed by PubChem (NCBI)