CAS 151911-33-0 appears in our catalog under these names: (S)–3–Amino–3–(4–fluorophenyl)propionic acid, H-β-Phe(4-F)-OH 98%, (S)-3-Amino-3-(4-fluorophenyl)propionic acid, 98%, 98%, (S)-beta-(p-Fluorophenyl)alanine, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 25g, 100g.
(3S)-3-amino-3-(4-fluorophenyl)propanoic acid (CAS 151911-33-0) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: (3S)-3-amino-3-(4-fluorophenyl)propanoic acid. InChIKey: CPGFMWPQXUXQRX-QMMMGPOBSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | (3S)-3-amino-3-(4-fluorophenyl)propanoic acid |
| InChIKey | CPGFMWPQXUXQRX-QMMMGPOBSA-N |
| SMILES | C1=CC(=CC=C1[C@H](CC(=O)O)N)F |
Computed by PubChem (NCBI)