CAS 151946-41-7 appears in our catalog under these names: 2–(4–Chlorophenyl)propan–2–amine hydrochloride, 2-(4-Chlorophenyl)propan-2-amine hydrochloride, 2-(4-Chlorophenyl)propan-2-amine hydrochloride, 95%, 95%, 1-(4-Chlorophenyl)-1-methylethylamine hydrochloride, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg.
2-(4-chlorophenyl)propan-2-amine;hydrochloride (CAS 151946-41-7) is a chemical compound with the molecular formula C9H13Cl2N and a molecular weight of 206.11 g/mol. IUPAC name: 2-(4-chlorophenyl)propan-2-amine;hydrochloride. InChIKey: QMHIYOHACPZOAB-UHFFFAOYSA-N.
| Molecular formula | C9H13Cl2N |
|---|---|
| Molecular weight | 206.11 g/mol |
| IUPAC name | 2-(4-chlorophenyl)propan-2-amine;hydrochloride |
| InChIKey | QMHIYOHACPZOAB-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)Cl)N.Cl |
Computed by PubChem (NCBI)