Products 1519538-34-1
CAS 1519538-34-1 is the registry number for 1-Benzyl-6-fluoro-1H-benzo[d]imidazol-2(3H)-one, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-benzyl-5-fluoro-1H-benzimidazol-2-one (CAS 1519538-34-1) is a chemical compound with the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. IUPAC name: 3-benzyl-5-fluoro-1H-benzimidazol-2-one. InChIKey: LZDVUVQNYRCLAB-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 3-benzyl-5-fluoro-1H-benzimidazol-2-one |
| InChIKey | LZDVUVQNYRCLAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C3=C(C=CC(=C3)F)NC2=O |
Computed by PubChem (NCBI)