Products 1520682-61-4
CAS 1520682-61-4 is the registry number for Methyl 1-(4-(trifluoromethyl)phenyl)pyrrolidine-3-carboxylate, 98%, 98%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Methyl 1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate (CAS 1520682-61-4) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: methyl 1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate. InChIKey: VAOPZWOWUNKJEP-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO2 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | methyl 1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-carboxylate |
| InChIKey | VAOPZWOWUNKJEP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN(C1)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)