Products 1521051-04-6

CAS 1521051-04-6 is the registry number for 3-Fluoro-5-(trifluoroacetyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid (CAS 1521051-04-6) is a chemical compound with the molecular formula C9H4F4O3 and a molecular weight of 236.12 g/mol. IUPAC name: 3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid. InChIKey: QVURWWNYRMFJNK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4F4O3
Molecular weight236.12 g/mol
IUPAC name3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid
InChIKeyQVURWWNYRMFJNK-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1C(=O)O)F)C(=O)C(F)(F)F

Computed by PubChem (NCBI)