CAS 1521051-04-6 is the registry number for 3-Fluoro-5-(trifluoroacetyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid (CAS 1521051-04-6) is a chemical compound with the molecular formula C9H4F4O3 and a molecular weight of 236.12 g/mol. IUPAC name: 3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid. InChIKey: QVURWWNYRMFJNK-UHFFFAOYSA-N.
| Molecular formula | C9H4F4O3 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 3-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid |
| InChIKey | QVURWWNYRMFJNK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)F)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)