CAS 159276-63-8 is the registry number for 2,2,3,3-Tetrafluoro-1,4-benzodioxene-6-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carbaldehyde (CAS 159276-63-8) is a chemical compound with the molecular formula C9H4F4O3 and a molecular weight of 236.12 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carbaldehyde. InChIKey: WQTQOBVIERTDBA-UHFFFAOYSA-N.
| Molecular formula | C9H4F4O3 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-1,4-benzodioxine-6-carbaldehyde |
| InChIKey | WQTQOBVIERTDBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)