CAS 1543093-16-8 appears in our catalog under these names: 2-Fluoro-5-(trifluoroacetyl)benzoic acid, 95%, 2-Fluoro-5-(trifluoroacetyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid (CAS 1543093-16-8) is a chemical compound with the molecular formula C9H4F4O3 and a molecular weight of 236.12 g/mol. IUPAC name: 2-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid. InChIKey: NOAIHQGBPNCCFI-UHFFFAOYSA-N.
| Molecular formula | C9H4F4O3 |
|---|---|
| Molecular weight | 236.12 g/mol |
| IUPAC name | 2-fluoro-5-(2,2,2-trifluoroacetyl)benzoic acid |
| InChIKey | NOAIHQGBPNCCFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C(F)(F)F)C(=O)O)F |
Computed by PubChem (NCBI)