CAS 1522530-72-8 appears in our catalog under these names: 5-Methyl-5h-pyrrolo[2,3-b]pyrazine-7-carboxylic acid, 95%, 5-Methyl-5H-pyrrolo(2,3-b)pyrazine-7-carboxylic acid, 97%, 5-methyl-5H-pyrrolo[2,3-b]pyrazine-7-carboxylic acid, 97%, 97%, 5-METHYL-5H-PYRROLO[2,3-B]PYRAZINE-7-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg, 500mg.
5-methylpyrrolo[2,3-b]pyrazine-7-carboxylic acid (CAS 1522530-72-8) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-methylpyrrolo[2,3-b]pyrazine-7-carboxylic acid. InChIKey: LNTXTPZUGLUCLS-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-methylpyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| InChIKey | LNTXTPZUGLUCLS-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=NC=CN=C21)C(=O)O |
Computed by PubChem (NCBI)