CAS 1523236-44-3 is the registry number for Ethyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg.
Ethyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 1523236-44-3) is a chemical compound with the molecular formula C16H23BO4 and a molecular weight of 290.2 g/mol. IUPAC name: ethyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: XBVWSRBCFRFDBZ-UHFFFAOYSA-N.
| Molecular formula | C16H23BO4 |
|---|---|
| Molecular weight | 290.2 g/mol |
| IUPAC name | ethyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | XBVWSRBCFRFDBZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OCC)C |
Computed by PubChem (NCBI)