CAS 15235-99-1 appears in our catalog under these names: 7-Hydroxy-5-methylflavone, 95%, 7-Hydroxy-5-methylflavone. Offered by: Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 10mg, 25mg, 50mg.
7-hydroxy-5-methyl-2-phenylchromen-4-one (CAS 15235-99-1) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 7-hydroxy-5-methyl-2-phenylchromen-4-one. InChIKey: QGHXBJKZPBTQQL-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 7-hydroxy-5-methyl-2-phenylchromen-4-one |
| InChIKey | QGHXBJKZPBTQQL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=O)C=C(O2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)