Products 500536-41-4
CAS 500536-41-4 appears in our catalog under these names: 2,7-Dimethyl-9-fluorenone-4-carboxylic acid, 95%, 2,7-Dimethyl-9-oxo-9H-fluorene-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
2,7-dimethyl-9-oxofluorene-4-carboxylic acid (CAS 500536-41-4) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 2,7-dimethyl-9-oxofluorene-4-carboxylic acid. InChIKey: ATPRNYZONXAEOW-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 2,7-dimethyl-9-oxofluorene-4-carboxylic acid |
| InChIKey | ATPRNYZONXAEOW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=C(C2=O)C=C(C=C3C(=O)O)C |
Computed by PubChem (NCBI)