CAS 288401-04-7 appears in our catalog under these names: 4'-Hydroxy-6-methylflavone, 95%, 2-(4-Hydroxyphenyl)-6-methyl-4H-chromen-4-one, 97%, 4'-Hydroxy-6-methylflavone, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 5g.
2-(4-hydroxyphenyl)-6-methylchromen-4-one (CAS 288401-04-7) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-6-methylchromen-4-one. InChIKey: YAACYYNCHMHECD-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-6-methylchromen-4-one |
| InChIKey | YAACYYNCHMHECD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=CC2=O)C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)