Products 1523570-98-0

CAS 1523570-98-0 is the registry number for 4-((4-Ethyl-6-isopropyl-1,3,5-triazin-2-yl)thio)butanoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[(4-ethyl-6-propan-2-yl-1,3,5-triazin-2-yl)sulfanyl]butanoic acid (CAS 1523570-98-0) is a chemical compound with the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. IUPAC name: 4-[(4-ethyl-6-propan-2-yl-1,3,5-triazin-2-yl)sulfanyl]butanoic acid. InChIKey: PBMIABRJOXWCNX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19N3O2S
Molecular weight269.37 g/mol
IUPAC name4-[(4-ethyl-6-propan-2-yl-1,3,5-triazin-2-yl)sulfanyl]butanoic acid
InChIKeyPBMIABRJOXWCNX-UHFFFAOYSA-N
SMILESCCC1=NC(=NC(=N1)SCCCC(=O)O)C(C)C

Computed by PubChem (NCBI)