Products 1523606-40-7

CAS 1523606-40-7 appears in our catalog under these names: 2-(trans-3-Aminocyclobutyl)acetic acid hydrochloride, 97%, rac-2-((1R,3R)-3-Aminocyclobutyl)acetic acid hydrochloride, 2-(trans-3-Aminocyclobutyl)acetic acid hydrochloride, 97%, 97%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 10g, 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-aminocyclobutyl)acetic acid;hydrochloride (CAS 1523606-40-7) is a chemical compound with the molecular formula C6H12ClNO2 and a molecular weight of 165.62 g/mol. IUPAC name: 2-(3-aminocyclobutyl)acetic acid;hydrochloride. InChIKey: VULUUIGASJOBOK-UHFFFAOYSA-N.

Identity
Molecular formulaC6H12ClNO2
Molecular weight165.62 g/mol
IUPAC name2-(3-aminocyclobutyl)acetic acid;hydrochloride
InChIKeyVULUUIGASJOBOK-UHFFFAOYSA-N
SMILESC1C(CC1N)CC(=O)O.Cl

Computed by PubChem (NCBI)