CAS 1523618-15-6 appears in our catalog under these names: Toluene-4-sulfonic acid 1-cyano-cyclobutylmethyl ester, 95%, (1-Cyanocyclobutyl)methyl 4-methylbenzenesulfonate, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g, 100mg.
(1-cyanocyclobutyl)methyl 4-methylbenzenesulfonate (CAS 1523618-15-6) is a chemical compound with the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. IUPAC name: (1-cyanocyclobutyl)methyl 4-methylbenzenesulfonate. InChIKey: LORKGTUDFYNINB-UHFFFAOYSA-N.
| Molecular formula | C13H15NO3S |
|---|---|
| Molecular weight | 265.33 g/mol |
| IUPAC name | (1-cyanocyclobutyl)methyl 4-methylbenzenesulfonate |
| InChIKey | LORKGTUDFYNINB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC2(CCC2)C#N |
Computed by PubChem (NCBI)