Products 1539497-03-4

CAS 1539497-03-4 is the registry number for 4-Methyl-2-(3-oxo-1,2-benzisothiazol-2(3h)-yl)pentanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

4-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid (CAS 1539497-03-4) is a chemical compound with the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. IUPAC name: 4-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid. InChIKey: WTOCONRTVKSQIG-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO3S
Molecular weight265.33 g/mol
IUPAC name4-methyl-2-(3-oxo-1,2-benzothiazol-2-yl)pentanoic acid
InChIKeyWTOCONRTVKSQIG-UHFFFAOYSA-N
SMILESCC(C)CC(C(=O)O)N1C(=O)C2=CC=CC=C2S1

Computed by PubChem (NCBI)