Products 721406-67-3

CAS 721406-67-3 is the registry number for 2-(2-Oxo-2-pyrrolidin-1-yl-ethylsulfanyl)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoic acid (CAS 721406-67-3) is a chemical compound with the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. IUPAC name: 2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoic acid. InChIKey: DTRQEZHZWYPZCM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO3S
Molecular weight265.33 g/mol
IUPAC name2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfanylbenzoic acid
InChIKeyDTRQEZHZWYPZCM-UHFFFAOYSA-N
SMILESC1CCN(C1)C(=O)CSC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)