Products 152404-45-0
CAS 152404-45-0 is the registry number for 4-Bromoanisole-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
1-bromo-2,3,5,6-tetradeuterio-4-methoxybenzene (CAS 152404-45-0) is a chemical compound with the molecular formula C7H7BrO and a molecular weight of 191.06 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-methoxybenzene. InChIKey: QJPJQTDYNZXKQF-QFFDRWTDSA-N.
| Molecular formula | C7H7BrO |
|---|---|
| Molecular weight | 191.06 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-methoxybenzene |
| InChIKey | QJPJQTDYNZXKQF-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)