Products 1538556-42-1
CAS 1538556-42-1 is the registry number for 4-Bromoanisole-13C6. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
1-bromo-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (CAS 1538556-42-1) is a chemical compound with the molecular formula C7H7BrO and a molecular weight of 192.99 g/mol. IUPAC name: 1-bromo-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene. InChIKey: QJPJQTDYNZXKQF-WBJZHHNVSA-N.
| Molecular formula | C7H7BrO |
|---|---|
| Molecular weight | 192.99 g/mol |
| IUPAC name | 1-bromo-4-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| InChIKey | QJPJQTDYNZXKQF-WBJZHHNVSA-N |
| SMILES | CO[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)Br |
Computed by PubChem (NCBI)