CAS 653588-30-8 is the registry number for 4–METHOXYBROMOBENZENE–D7. Offered by: GLPBio. Available pack sizes: 25mg.
1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzene (CAS 653588-30-8) is a chemical compound with the molecular formula C7H7BrO and a molecular weight of 194.08 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzene. InChIKey: QJPJQTDYNZXKQF-AAYPNNLASA-N.
| Molecular formula | C7H7BrO |
|---|---|
| Molecular weight | 194.08 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-(trideuteriomethoxy)benzene |
| InChIKey | QJPJQTDYNZXKQF-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OC([2H])([2H])[2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)