Products 1524165-88-5
CAS 1524165-88-5 appears in our catalog under these names: 4-Fluoro-N-(oxetan-3-yl)benzenesulfonamide, 98%, 2-Cyclopropylglycine, 98%, 98%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
4-fluoro-N-(oxetan-3-yl)benzenesulfonamide (CAS 1524165-88-5) is a chemical compound with the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. IUPAC name: 4-fluoro-N-(oxetan-3-yl)benzenesulfonamide. InChIKey: ASFHWFYVHSCIRJ-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3S |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-fluoro-N-(oxetan-3-yl)benzenesulfonamide |
| InChIKey | ASFHWFYVHSCIRJ-UHFFFAOYSA-N |
| SMILES | C1C(CO1)NS(=O)(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)