CAS 381229-76-1 is the registry number for 2-Fluoro-5-formyl-n,n-dimethylbenzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide (CAS 381229-76-1) is a chemical compound with the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. IUPAC name: 2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide. InChIKey: UIHNZHVGAYTTPY-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3S |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 2-fluoro-5-formyl-N,N-dimethylbenzenesulfonamide |
| InChIKey | UIHNZHVGAYTTPY-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=CC(=C1)C=O)F |
Computed by PubChem (NCBI)