CAS 33719-21-0 is the registry number for 4-(Acetamidomethyl)benzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(acetamidomethyl)benzenesulfonyl fluoride (CAS 33719-21-0) is a chemical compound with the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. IUPAC name: 4-(acetamidomethyl)benzenesulfonyl fluoride. InChIKey: MHDPNRPBTSKUAW-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO3S |
|---|---|
| Molecular weight | 231.25 g/mol |
| IUPAC name | 4-(acetamidomethyl)benzenesulfonyl fluoride |
| InChIKey | MHDPNRPBTSKUAW-UHFFFAOYSA-N |
| SMILES | CC(=O)NCC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)