Products 33719-21-0

CAS 33719-21-0 is the registry number for 4-(Acetamidomethyl)benzene-1-sulfonyl fluoride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

4-(acetamidomethyl)benzenesulfonyl fluoride (CAS 33719-21-0) is a chemical compound with the molecular formula C9H10FNO3S and a molecular weight of 231.25 g/mol. IUPAC name: 4-(acetamidomethyl)benzenesulfonyl fluoride. InChIKey: MHDPNRPBTSKUAW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10FNO3S
Molecular weight231.25 g/mol
IUPAC name4-(acetamidomethyl)benzenesulfonyl fluoride
InChIKeyMHDPNRPBTSKUAW-UHFFFAOYSA-N
SMILESCC(=O)NCC1=CC=C(C=C1)S(=O)(=O)F

Computed by PubChem (NCBI)