Products 1525120-73-3
CAS 1525120-73-3 appears in our catalog under these names: 2,3-Dihydro-3-hydroxy-1H-indene-5-carboxylic acid, 98%, 98%, 2,3-Dihydro-3-hydroxy-1H-indene-5-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 100mg.
3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid (CAS 1525120-73-3) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid. InChIKey: LWCVWFQTPKSGOI-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-hydroxy-2,3-dihydro-1H-indene-5-carboxylic acid |
| InChIKey | LWCVWFQTPKSGOI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1O)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)