Products 152538-59-5
CAS 152538-59-5 is the registry number for BTG 1640. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3S,3aR,7aR)-3-benzyl-2-methyl-3,3a,5,6,7,7a-hexahydro-1,2-benzoxazol-4-one (CAS 152538-59-5) is a chemical compound with the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. IUPAC name: (3S,3aR,7aR)-3-benzyl-2-methyl-3,3a,5,6,7,7a-hexahydro-1,2-benzoxazol-4-one. InChIKey: ALQXIMVNPRVWQA-CFVMTHIKSA-N.
| Molecular formula | C15H19NO2 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | (3S,3aR,7aR)-3-benzyl-2-methyl-3,3a,5,6,7,7a-hexahydro-1,2-benzoxazol-4-one |
| InChIKey | ALQXIMVNPRVWQA-CFVMTHIKSA-N |
| SMILES | CN1[C@H]([C@@H]2[C@H](O1)CCCC2=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)