Products 152540-76-6
CAS 152540-76-6 appears in our catalog under these names: 4'-a-C-Methyladenosine, 4’-Methyladenosine. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, Get quote.
(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-2-methyloxolane-3,4-diol (CAS 152540-76-6) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-2-methyloxolane-3,4-diol. InChIKey: ZYRABNSYSYDHMR-LRMGWDNHSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | (2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-2-(hydroxymethyl)-2-methyloxolane-3,4-diol |
| InChIKey | ZYRABNSYSYDHMR-LRMGWDNHSA-N |
| SMILES | C[C@]1([C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O)CO |
Computed by PubChem (NCBI)