CAS 1526-73-4 is the registry number for 2-Chloro-3-hydroxynaphthalene-1,4-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-hydroxynaphthalene-1,2-dione (CAS 1526-73-4) is a chemical compound with the molecular formula C10H5ClO3 and a molecular weight of 208.60 g/mol. IUPAC name: 3-chloro-4-hydroxynaphthalene-1,2-dione. InChIKey: FQTBBCHDEDQCQR-UHFFFAOYSA-N.
| Molecular formula | C10H5ClO3 |
|---|---|
| Molecular weight | 208.60 g/mol |
| IUPAC name | 3-chloro-4-hydroxynaphthalene-1,2-dione |
| InChIKey | FQTBBCHDEDQCQR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)C2=O)Cl)O |
Computed by PubChem (NCBI)